C42H66FeO2P2 — CID 137321453
cyclopentyl-bis(4-methoxy-3,5-dimethylphenyl)phosphane;dicyclohexyl(1-cyclopentylethyl)phosphane;iron (PubChem CID 137321453) has the molecular formula C42H66FeO2P2 and a molecular weight of 720.78 g/mol. Its IUPAC name is cyclopentyl-bis(4-methoxy-3,5-dimethylphenyl)phosphane;dicyclohexyl(1-cyclopentylethyl)phosphane;iron.
| Compound Name | cyclopentyl-bis(4-methoxy-3,5-dimethylphenyl)phosphane;dicyclohexyl(1-cyclopentylethyl)phosphane;iron |
|---|---|
| PubChem CID | 137321453 |
| Molecular Formula | C42H66FeO2P2 |
| Molecular Weight | 720.78 g/mol |
| Exact Mass | 720.39 |
| IUPAC Name | cyclopentyl-bis(4-methoxy-3,5-dimethylphenyl)phosphane;dicyclohexyl(1-cyclopentylethyl)phosphane;iron |
| SMILES | CC(C1CCCC1)P(C1CCCCC1)C1CCCCC1.COc1c(C)cc(P(c2cc(C)c(OC)c(C)c2)C2CCCC2)cc1C.[Fe] |
| InChI | InChI=1S/C23H31O2P.C19H35P.Fe/c1-15-11-20(12-16(2)22(15)24-5)26(19-9-7-8-10-19)21-13-17(3)23(25-6)18(4)14-21;1-16(17-10-8-9-11-17)20(18-12-4-2-5-13-18)19-14-6-3-7-15-19;/h11-14,19H,7-10H2,1-6H3;16-19H,2-15H2,1H3; |
| InChIKey | RPJGOLCBJAXTKA-UHFFFAOYSA-N |
| XLogP | 12.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.78 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|