C27H39O2P — CID 144514442
[(2R)-2-butylcyclopentyl]-bis(4-methoxy-3,5-dimethylphenyl)phosphane (PubChem CID 144514442) has the molecular formula C27H39O2P and a molecular weight of 426.58 g/mol. Its IUPAC name is [(2R)-2-butylcyclopentyl]-bis(4-methoxy-3,5-dimethylphenyl)phosphane.
| Compound Name | [(2R)-2-butylcyclopentyl]-bis(4-methoxy-3,5-dimethylphenyl)phosphane |
|---|---|
| PubChem CID | 144514442 |
| Molecular Formula | C27H39O2P |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | [(2R)-2-butylcyclopentyl]-bis(4-methoxy-3,5-dimethylphenyl)phosphane |
| SMILES | CCCC[C@@H]1CCCC1P(c1cc(C)c(OC)c(C)c1)c1cc(C)c(OC)c(C)c1 |
| InChI | InChI=1S/C27H39O2P/c1-8-9-11-22-12-10-13-25(22)30(23-14-18(2)26(28-6)19(3)15-23)24-16-20(4)27(29-7)21(5)17-24/h14-17,22,25H,8-13H2,1-7H3/t22-,25?/m1/s1 |
| InChIKey | PGUACBODJCRFAN-UFUCKMQHSA-N |
| XLogP | 6.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|