C26H35O2P — CID 144514405
bis(4-methoxy-3,5-dimethylphenyl)-[(8R)-spiro[3.4]octan-8-yl]phosphane (PubChem CID 144514405) has the molecular formula C26H35O2P and a molecular weight of 410.54 g/mol. Its IUPAC name is bis(4-methoxy-3,5-dimethylphenyl)-[(8R)-spiro[3.4]octan-8-yl]phosphane.
| Compound Name | bis(4-methoxy-3,5-dimethylphenyl)-[(8R)-spiro[3.4]octan-8-yl]phosphane |
|---|---|
| PubChem CID | 144514405 |
| Molecular Formula | C26H35O2P |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | bis(4-methoxy-3,5-dimethylphenyl)-[(8R)-spiro[3.4]octan-8-yl]phosphane |
| SMILES | COc1c(C)cc(P(c2cc(C)c(OC)c(C)c2)[C@@H]2CCCC23CCC3)cc1C |
| InChI | InChI=1S/C26H35O2P/c1-17-13-21(14-18(2)24(17)27-5)29(23-9-7-10-26(23)11-8-12-26)22-15-19(3)25(28-6)20(4)16-22/h13-16,23H,7-12H2,1-6H3/t23-/m1/s1 |
| InChIKey | AFMGDZKSUNZFTM-HSZRJFAPSA-N |
| XLogP | 6.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|