C12H16O2 — CID 130057399
5-cyclopropyloxy-2-methoxy-1,3-dimethylbenzene (PubChem CID 130057399) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 5-cyclopropyloxy-2-methoxy-1,3-dimethylbenzene.
| Compound Name | 5-cyclopropyloxy-2-methoxy-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 130057399 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 5-cyclopropyloxy-2-methoxy-1,3-dimethylbenzene |
| SMILES | COc1c(C)cc(OC2CC2)cc1C |
| InChI | InChI=1S/C12H16O2/c1-8-6-11(14-10-4-5-10)7-9(2)12(8)13-3/h6-7,10H,4-5H2,1-3H3 |
| InChIKey | XZDHAEMJYSBBJG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |