About ethane;ethyl-bis(4-methoxy-3,5-dimethylphenyl)phosphane
ethane;ethyl-bis(4-methoxy-3,5-dimethylphenyl)phosphane (PubChem CID 143834388) has the molecular formula C22H33O2P
and a molecular weight of 360.48 g/mol. Its IUPAC name is ethane;ethyl-bis(4-methoxy-3,5-dimethylphenyl)phosphane.
Molecular Properties
| Compound Name | ethane;ethyl-bis(4-methoxy-3,5-dimethylphenyl)phosphane |
| PubChem CID | 143834388 |
| Molecular Formula | C22H33O2P |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | ethane;ethyl-bis(4-methoxy-3,5-dimethylphenyl)phosphane |
| SMILES | CC.CCP(c1cc(C)c(OC)c(C)c1)c1cc(C)c(OC)c(C)c1 |
| InChI | InChI=1S/C20H27O2P.C2H6/c1-8-23(17-9-13(2)19(21-6)14(3)10-17)18-11-15(4)20(22-7)16(5)12-18;1-2/h9-12H,8H2,1-7H3;1-2H3 |
| InChIKey | MMFBTLSWTHSLFR-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethyl-bis(4-methoxy-3,5-dimethylphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethyl-bis(4-methoxy-3,5-dimethylphenyl)phosphane?
The IUPAC name of ethane;ethyl-bis(4-methoxy-3,5-dimethylphenyl)phosphane (CID 143834388) is ethane;ethyl-bis(4-methoxy-3,5-dimethylphenyl)phosphane.
What is the SMILES notation for ethane;ethyl-bis(4-methoxy-3,5-dimethylphenyl)phosphane?
The canonical SMILES for ethane;ethyl-bis(4-methoxy-3,5-dimethylphenyl)phosphane is CC.CCP(c1cc(C)c(OC)c(C)c1)c1cc(C)c(OC)c(C)c1.
What is the InChIKey of ethane;ethyl-bis(4-methoxy-3,5-dimethylphenyl)phosphane?
The InChIKey is MMFBTLSWTHSLFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27O2P.C2H6/c1-8-23(17-9-13(2)19(21-6)14(3)10-17)18-11-15(4)20(22-7)16(5)12-18;1-2/h9-12H,8H2,1-7H3;1-2H3.
What are the key properties of ethane;ethyl-bis(4-methoxy-3,5-dimethylphenyl)phosphane?
ethane;ethyl-bis(4-methoxy-3,5-dimethylphenyl)phosphane has a molecular weight of 360.48 g/mol, XLogP of 5.42, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl-bis(4-methoxy-3,5-dimethylphenyl)phosphane is sourced from PubChem (CID 143834388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).