C12H21NO2 — CID 154695651
ethane;O-[(4-methoxy-3,5-dimethylphenyl)methyl]hydroxylamine (PubChem CID 154695651) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is ethane;O-[(4-methoxy-3,5-dimethylphenyl)methyl]hydroxylamine.
| Compound Name | ethane;O-[(4-methoxy-3,5-dimethylphenyl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 154695651 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | ethane;O-[(4-methoxy-3,5-dimethylphenyl)methyl]hydroxylamine |
| SMILES | CC.COc1c(C)cc(CON)cc1C |
| InChI | InChI=1S/C10H15NO2.C2H6/c1-7-4-9(6-13-11)5-8(2)10(7)12-3;1-2/h4-5H,6,11H2,1-3H3;1-2H3 |
| InChIKey | IUASWVMIZNUAKK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|