C11H13ClO3 — CID 83823720
(4-methoxy-3,5-dimethylphenyl)methyl carbonochloridate (PubChem CID 83823720) has the molecular formula C11H13ClO3 and a molecular weight of 228.67 g/mol. Its IUPAC name is (4-methoxy-3,5-dimethylphenyl)methyl carbonochloridate.
| Compound Name | (4-methoxy-3,5-dimethylphenyl)methyl carbonochloridate |
|---|---|
| PubChem CID | 83823720 |
| Molecular Formula | C11H13ClO3 |
| Molecular Weight | 228.67 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | (4-methoxy-3,5-dimethylphenyl)methyl carbonochloridate |
| SMILES | COc1c(C)cc(COC(=O)Cl)cc1C |
| InChI | InChI=1S/C11H13ClO3/c1-7-4-9(6-15-11(12)13)5-8(2)10(7)14-3/h4-5H,6H2,1-3H3 |
| InChIKey | MIEHQKCETLCUMO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.67 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|