C42H64O2P2 — CID 11250875
dicyclohexyl-[2-(6-dicyclohexylphosphanyl-3-methoxy-2,4-dimethylphenyl)-4-methoxy-3,5-dimethylphenyl]phosphane (PubChem CID 11250875) has the molecular formula C42H64O2P2 and a molecular weight of 662.92 g/mol. Its IUPAC name is dicyclohexyl-[2-(6-dicyclohexylphosphanyl-3-methoxy-2,4-dimethylphenyl)-4-methoxy-3,5-dimethylphenyl]phosphane.
| Compound Name | dicyclohexyl-[2-(6-dicyclohexylphosphanyl-3-methoxy-2,4-dimethylphenyl)-4-methoxy-3,5-dimethylphenyl]phosphane |
|---|---|
| PubChem CID | 11250875 |
| Molecular Formula | C42H64O2P2 |
| Molecular Weight | 662.92 g/mol |
| Exact Mass | 662.44 |
| IUPAC Name | dicyclohexyl-[2-(6-dicyclohexylphosphanyl-3-methoxy-2,4-dimethylphenyl)-4-methoxy-3,5-dimethylphenyl]phosphane |
| SMILES | COc1c(C)cc(P(C2CCCCC2)C2CCCCC2)c(-c2c(P(C3CCCCC3)C3CCCCC3)cc(C)c(OC)c2C)c1C |
| InChI | InChI=1S/C42H64O2P2/c1-29-27-37(45(33-19-11-7-12-20-33)34-21-13-8-14-22-34)39(31(3)41(29)43-5)40-32(4)42(44-6)30(2)28-38(40)46(35-23-15-9-16-24-35)36-25-17-10-18-26-36/h27-28,33-36H,7-26H2,1-6H3 |
| InChIKey | SFGHVJXCVVPKAT-UHFFFAOYSA-N |
| XLogP | 12.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.92 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|