C48H52O5P2 — CID 149137608
[2-[2-bis(4-methoxy-3,5-dimethylphenyl)phosphanylphenoxy]phenyl]-bis(4-methoxy-3,5-dimethylphenyl)phosphane (PubChem CID 149137608) has the molecular formula C48H52O5P2 and a molecular weight of 770.89 g/mol. Its IUPAC name is [2-[2-bis(4-methoxy-3,5-dimethylphenyl)phosphanylphenoxy]phenyl]-bis(4-methoxy-3,5-dimethylphenyl)phosphane.
| Compound Name | [2-[2-bis(4-methoxy-3,5-dimethylphenyl)phosphanylphenoxy]phenyl]-bis(4-methoxy-3,5-dimethylphenyl)phosphane |
|---|---|
| PubChem CID | 149137608 |
| Molecular Formula | C48H52O5P2 |
| Molecular Weight | 770.89 g/mol |
| Exact Mass | 770.33 |
| IUPAC Name | [2-[2-bis(4-methoxy-3,5-dimethylphenyl)phosphanylphenoxy]phenyl]-bis(4-methoxy-3,5-dimethylphenyl)phosphane |
| SMILES | COc1c(C)cc(P(c2cc(C)c(OC)c(C)c2)c2ccccc2Oc2ccccc2P(c2cc(C)c(OC)c(C)c2)c2cc(C)c(OC)c(C)c2)cc1C |
| InChI | InChI=1S/C48H52O5P2/c1-29-21-37(22-30(2)45(29)49-9)54(38-23-31(3)46(50-10)32(4)24-38)43-19-15-13-17-41(43)53-42-18-14-16-20-44(42)55(39-25-33(5)47(51-11)34(6)26-39)40-27-35(7)48(52-12)36(8)28-40/h13-28H,1-12H3 |
| InChIKey | RFWCWUVNSVLWLG-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.89 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|