C36H28ClO5P2Rh- — CID 135084630
[2-(2-diphenylphosphanylphenoxy)phenyl]-diphenylphosphane;rhodium;perchlorate (PubChem CID 135084630) has the molecular formula C36H28ClO5P2Rh- and a molecular weight of 740.92 g/mol. Its IUPAC name is [2-(2-diphenylphosphanylphenoxy)phenyl]-diphenylphosphane;rhodium;perchlorate.
| Compound Name | [2-(2-diphenylphosphanylphenoxy)phenyl]-diphenylphosphane;rhodium;perchlorate |
|---|---|
| PubChem CID | 135084630 |
| Molecular Formula | C36H28ClO5P2Rh- |
| Molecular Weight | 740.92 g/mol |
| Exact Mass | 740.02 |
| IUPAC Name | [2-(2-diphenylphosphanylphenoxy)phenyl]-diphenylphosphane;rhodium;perchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].[Rh].c1ccc(P(c2ccccc2)c2ccccc2Oc2ccccc2P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H28OP2.ClHO4.Rh/c1-5-17-29(18-6-1)38(30-19-7-2-8-20-30)35-27-15-13-25-33(35)37-34-26-14-16-28-36(34)39(31-21-9-3-10-22-31)32-23-11-4-12-24-32;2-1(3,4)5;/h1-28H;(H,2,3,4,5);/p-1 |
| InChIKey | OLFRPNTYMKFQIB-UHFFFAOYSA-M |
| XLogP | 2.24 |
| TPSA | 101.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.92 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|