C50H54O14P2 — CID 146519174
4-[[2-[2-bis(3,4,5-trimethoxyphenyl)phosphanyl-6-methoxyphenyl]-3-methoxyphenyl]-(3,4,5-trimethoxyphenyl)phosphanyl]-2,6-dimethoxybenzaldehyde (PubChem CID 146519174) has the molecular formula C50H54O14P2 and a molecular weight of 940.92 g/mol. Its IUPAC name is 4-[[2-[2-bis(3,4,5-trimethoxyphenyl)phosphanyl-6-methoxyphenyl]-3-methoxyphenyl]-(3,4,5-trimethoxyphenyl)phosphanyl]-2,6-dimethoxybenzaldehyde.
| Compound Name | 4-[[2-[2-bis(3,4,5-trimethoxyphenyl)phosphanyl-6-methoxyphenyl]-3-methoxyphenyl]-(3,4,5-trimethoxyphenyl)phosphanyl]-2,6-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 146519174 |
| Molecular Formula | C50H54O14P2 |
| Molecular Weight | 940.92 g/mol |
| Exact Mass | 940.30 |
| IUPAC Name | 4-[[2-[2-bis(3,4,5-trimethoxyphenyl)phosphanyl-6-methoxyphenyl]-3-methoxyphenyl]-(3,4,5-trimethoxyphenyl)phosphanyl]-2,6-dimethoxybenzaldehyde |
| SMILES | COc1cc(P(c2cc(OC)c(OC)c(OC)c2)c2cccc(OC)c2-c2c(OC)cccc2P(c2cc(OC)c(OC)c(OC)c2)c2cc(OC)c(OC)c(OC)c2)cc(OC)c1C=O |
| InChI | InChI=1S/C50H54O14P2/c1-52-34-16-14-18-44(65(29-20-36(54-3)33(28-51)37(21-29)55-4)30-22-38(56-5)48(62-11)39(23-30)57-6)46(34)47-35(53-2)17-15-19-45(47)66(31-24-40(58-7)49(63-12)41(25-31)59-8)32-26-42(60-9)50(64-13)43(27-32)61-10/h14-28H,1-13H3 |
| InChIKey | MILIKRQDINQQQQ-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 137.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.92 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|