C18H21O4P — CID 90687309
2,6-dimethoxy-4-[phenyl(propoxy)phosphanyl]benzaldehyde (PubChem CID 90687309) has the molecular formula C18H21O4P and a molecular weight of 332.34 g/mol. Its IUPAC name is 2,6-dimethoxy-4-[phenyl(propoxy)phosphanyl]benzaldehyde.
| Compound Name | 2,6-dimethoxy-4-[phenyl(propoxy)phosphanyl]benzaldehyde |
|---|---|
| PubChem CID | 90687309 |
| Molecular Formula | C18H21O4P |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2,6-dimethoxy-4-[phenyl(propoxy)phosphanyl]benzaldehyde |
| SMILES | CCCOP(c1ccccc1)c1cc(OC)c(C=O)c(OC)c1 |
| InChI | InChI=1S/C18H21O4P/c1-4-10-22-23(14-8-6-5-7-9-14)15-11-17(20-2)16(13-19)18(12-15)21-3/h5-9,11-13H,4,10H2,1-3H3 |
| InChIKey | SKZDTUDNVKCYNA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|