C16H17O4P — CID 91083738
2,6-dimethoxy-4-[methoxy(phenyl)phosphanyl]benzaldehyde (PubChem CID 91083738) has the molecular formula C16H17O4P and a molecular weight of 304.28 g/mol. Its IUPAC name is 2,6-dimethoxy-4-[methoxy(phenyl)phosphanyl]benzaldehyde.
| Compound Name | 2,6-dimethoxy-4-[methoxy(phenyl)phosphanyl]benzaldehyde |
|---|---|
| PubChem CID | 91083738 |
| Molecular Formula | C16H17O4P |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2,6-dimethoxy-4-[methoxy(phenyl)phosphanyl]benzaldehyde |
| SMILES | COc1cc(P(OC)c2ccccc2)cc(OC)c1C=O |
| InChI | InChI=1S/C16H17O4P/c1-18-15-9-13(10-16(19-2)14(15)11-17)21(20-3)12-7-5-4-6-8-12/h4-11H,1-3H3 |
| InChIKey | DWPFRMKHYQESNC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|