C17H18O6S — CID 139990319
(2-formyl-5,6-dimethoxy-3-methylphenyl) phenylmethanesulfonate (PubChem CID 139990319) has the molecular formula C17H18O6S and a molecular weight of 350.39 g/mol. Its IUPAC name is (2-formyl-5,6-dimethoxy-3-methylphenyl) phenylmethanesulfonate.
| Compound Name | (2-formyl-5,6-dimethoxy-3-methylphenyl) phenylmethanesulfonate |
|---|---|
| PubChem CID | 139990319 |
| Molecular Formula | C17H18O6S |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | (2-formyl-5,6-dimethoxy-3-methylphenyl) phenylmethanesulfonate |
| SMILES | COc1cc(C)c(C=O)c(OS(=O)(=O)Cc2ccccc2)c1OC |
| InChI | InChI=1S/C17H18O6S/c1-12-9-15(21-2)17(22-3)16(14(12)10-18)23-24(19,20)11-13-7-5-4-6-8-13/h4-10H,11H2,1-3H3 |
| InChIKey | NTQZFMODDJLJSY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|