C19H19NO7S — CID 123361953
[2-amino-5-(2,6-dimethoxyphenyl)-4-hydroxyfuran-3-yl] phenylmethanesulfonate (PubChem CID 123361953) has the molecular formula C19H19NO7S and a molecular weight of 405.43 g/mol. Its IUPAC name is [2-amino-5-(2,6-dimethoxyphenyl)-4-hydroxyfuran-3-yl] phenylmethanesulfonate.
| Compound Name | [2-amino-5-(2,6-dimethoxyphenyl)-4-hydroxyfuran-3-yl] phenylmethanesulfonate |
|---|---|
| PubChem CID | 123361953 |
| Molecular Formula | C19H19NO7S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | [2-amino-5-(2,6-dimethoxyphenyl)-4-hydroxyfuran-3-yl] phenylmethanesulfonate |
| SMILES | COc1cccc(OC)c1-c1oc(N)c(OS(=O)(=O)Cc2ccccc2)c1O |
| InChI | InChI=1S/C19H19NO7S/c1-24-13-9-6-10-14(25-2)15(13)17-16(21)18(19(20)26-17)27-28(22,23)11-12-7-4-3-5-8-12/h3-10,21H,11,20H2,1-2H3 |
| InChIKey | IMFFOAICTVHKKS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 121.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|