C8H12BO5 — CID 68597712
2,6-Dimethoxy-phenol boronic acid (PubChem CID 68597712) has the molecular formula C8H12BO5 and a molecular weight of 198.99 g/mol.
| Compound Name | 2,6-Dimethoxy-phenol boronic acid |
|---|---|
| PubChem CID | 68597712 |
| Molecular Formula | C8H12BO5 |
| Molecular Weight | 198.99 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | — |
| SMILES | COc1cccc(OC)c1O.O[B]O |
| InChI | InChI=1S/C8H10O3.BH2O2/c1-10-6-4-3-5-7(11-2)8(6)9;2-1-3/h3-5,9H,1-2H3;2-3H |
| InChIKey | CIVRFBFKNUHJCG-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.99 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|