C27H24O9S3 — CID 18625063
[2,3-bis(benzylsulfonyloxy)phenyl] phenylmethanesulfonate (PubChem CID 18625063) has the molecular formula C27H24O9S3 and a molecular weight of 588.68 g/mol. Its IUPAC name is [2,3-bis(benzylsulfonyloxy)phenyl] phenylmethanesulfonate.
| Compound Name | [2,3-bis(benzylsulfonyloxy)phenyl] phenylmethanesulfonate |
|---|---|
| PubChem CID | 18625063 |
| Molecular Formula | C27H24O9S3 |
| Molecular Weight | 588.68 g/mol |
| Exact Mass | 588.06 |
| IUPAC Name | [2,3-bis(benzylsulfonyloxy)phenyl] phenylmethanesulfonate |
| SMILES | O=S(=O)(Cc1ccccc1)Oc1cccc(OS(=O)(=O)Cc2ccccc2)c1OS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C27H24O9S3/c28-37(29,19-22-11-4-1-5-12-22)34-25-17-10-18-26(35-38(30,31)20-23-13-6-2-7-14-23)27(25)36-39(32,33)21-24-15-8-3-9-16-24/h1-18H,19-21H2 |
| InChIKey | JGRMADZUZPTZEP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.68 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|