C12H15Cl3O9S3 — CID 19421172
[2,3-bis(2-chloroethylsulfonyloxy)phenyl] 2-chloroethanesulfonate (PubChem CID 19421172) has the molecular formula C12H15Cl3O9S3 and a molecular weight of 505.80 g/mol. Its IUPAC name is [2,3-bis(2-chloroethylsulfonyloxy)phenyl] 2-chloroethanesulfonate.
| Compound Name | [2,3-bis(2-chloroethylsulfonyloxy)phenyl] 2-chloroethanesulfonate |
|---|---|
| PubChem CID | 19421172 |
| Molecular Formula | C12H15Cl3O9S3 |
| Molecular Weight | 505.80 g/mol |
| Exact Mass | 503.89 |
| IUPAC Name | [2,3-bis(2-chloroethylsulfonyloxy)phenyl] 2-chloroethanesulfonate |
| SMILES | O=S(=O)(CCCl)Oc1cccc(OS(=O)(=O)CCCl)c1OS(=O)(=O)CCCl |
| InChI | InChI=1S/C12H15Cl3O9S3/c13-4-7-25(16,17)22-10-2-1-3-11(23-26(18,19)8-5-14)12(10)24-27(20,21)9-6-15/h1-3H,4-9H2 |
| InChIKey | PANCAHSHNLXKFV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.80 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|