C18H9F21O9S3 — CID 21102715
[3,4-bis(2,2,3,3,4,4,4-heptafluorobutylsulfonyloxy)phenyl] 2,2,3,3,4,4,4-heptafluorobutane-1-sulfonate (PubChem CID 21102715) has the molecular formula C18H9F21O9S3 and a molecular weight of 864.42 g/mol. Its IUPAC name is [3,4-bis(2,2,3,3,4,4,4-heptafluorobutylsulfonyloxy)phenyl] 2,2,3,3,4,4,4-heptafluorobutane-1-sulfonate.
| Compound Name | [3,4-bis(2,2,3,3,4,4,4-heptafluorobutylsulfonyloxy)phenyl] 2,2,3,3,4,4,4-heptafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 21102715 |
| Molecular Formula | C18H9F21O9S3 |
| Molecular Weight | 864.42 g/mol |
| Exact Mass | 863.91 |
| IUPAC Name | [3,4-bis(2,2,3,3,4,4,4-heptafluorobutylsulfonyloxy)phenyl] 2,2,3,3,4,4,4-heptafluorobutane-1-sulfonate |
| SMILES | O=S(=O)(CC(F)(F)C(F)(F)C(F)(F)F)Oc1ccc(OS(=O)(=O)CC(F)(F)C(F)(F)C(F)(F)F)c(OS(=O)(=O)CC(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C18H9F21O9S3/c19-10(20,13(25,26)16(31,32)33)4-49(40,41)46-7-1-2-8(47-50(42,43)5-11(21,22)14(27,28)17(34,35)36)9(3-7)48-51(44,45)6-12(23,24)15(29,30)18(37,38)39/h1-3H,4-6H2 |
| InChIKey | CBLHPOVYEPYBTM-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.42 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|