C14H11NO5S — CID 141170580
(2-oxo-3H-1,3-benzoxazol-4-yl) phenylmethanesulfonate (PubChem CID 141170580) has the molecular formula C14H11NO5S and a molecular weight of 305.31 g/mol. Its IUPAC name is (2-oxo-3H-1,3-benzoxazol-4-yl) phenylmethanesulfonate.
| Compound Name | (2-oxo-3H-1,3-benzoxazol-4-yl) phenylmethanesulfonate |
|---|---|
| PubChem CID | 141170580 |
| Molecular Formula | C14H11NO5S |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | (2-oxo-3H-1,3-benzoxazol-4-yl) phenylmethanesulfonate |
| SMILES | O=c1[nH]c2c(OS(=O)(=O)Cc3ccccc3)cccc2o1 |
| InChI | InChI=1S/C14H11NO5S/c16-14-15-13-11(19-14)7-4-8-12(13)20-21(17,18)9-10-5-2-1-3-6-10/h1-8H,9H2,(H,15,16) |
| InChIKey | TWMGWIZIEGDFSB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|