C9H9NO3 — CID 117277918
4-(2-hydroxyethyl)-3H-1,3-benzoxazol-2-one (PubChem CID 117277918) has the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. Its IUPAC name is 4-(2-hydroxyethyl)-3H-1,3-benzoxazol-2-one.
| Compound Name | 4-(2-hydroxyethyl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 117277918 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 4-(2-hydroxyethyl)-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2c(CCO)cccc2o1 |
| InChI | InChI=1S/C9H9NO3/c11-5-4-6-2-1-3-7-8(6)10-9(12)13-7/h1-3,11H,4-5H2,(H,10,12) |
| InChIKey | LRNBOZBBVGOOOC-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |