C10H11NO3 — CID 19086896
4-(3-hydroxypropyl)-3H-1,3-benzoxazol-2-one (PubChem CID 19086896) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is 4-(3-hydroxypropyl)-3H-1,3-benzoxazol-2-one.
| Compound Name | 4-(3-hydroxypropyl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 19086896 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 4-(3-hydroxypropyl)-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2c(CCCO)cccc2o1 |
| InChI | InChI=1S/C10H11NO3/c12-6-2-4-7-3-1-5-8-9(7)11-10(13)14-8/h1,3,5,12H,2,4,6H2,(H,11,13) |
| InChIKey | PHPQERCNALFZFF-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |