C8H8N2O3 — CID 117278228
4-[(hydroxyamino)methyl]-3H-1,3-benzoxazol-2-one (PubChem CID 117278228) has the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. Its IUPAC name is 4-[(hydroxyamino)methyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 4-[(hydroxyamino)methyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 117278228 |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 4-[(hydroxyamino)methyl]-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2c(CNO)cccc2o1 |
| InChI | InChI=1S/C8H8N2O3/c11-8-10-7-5(4-9-12)2-1-3-6(7)13-8/h1-3,9,12H,4H2,(H,10,11) |
| InChIKey | GNCSFNBBZBPSNZ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 78.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|