C7H5NO2S — CID 89427978
4-sulfanyl-3H-1,3-benzoxazol-2-one (PubChem CID 89427978) has the molecular formula C7H5NO2S and a molecular weight of 167.19 g/mol. Its IUPAC name is 4-sulfanyl-3H-1,3-benzoxazol-2-one.
| Compound Name | 4-sulfanyl-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 89427978 |
| Molecular Formula | C7H5NO2S |
| Molecular Weight | 167.19 g/mol |
| Exact Mass | 167.00 |
| IUPAC Name | 4-sulfanyl-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2c(S)cccc2o1 |
| InChI | InChI=1S/C7H5NO2S/c9-7-8-6-4(10-7)2-1-3-5(6)11/h1-3,11H,(H,8,9) |
| InChIKey | ACGFIERCMYVBDI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.19 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|