C11H8N2O2 — CID 57163944
9-amino-1H-benzo[e][1,3]benzoxazol-2-one (PubChem CID 57163944) has the molecular formula C11H8N2O2 and a molecular weight of 200.20 g/mol. Its IUPAC name is 9-amino-1H-benzo[e][1,3]benzoxazol-2-one.
| Compound Name | 9-amino-1H-benzo[e][1,3]benzoxazol-2-one |
|---|---|
| PubChem CID | 57163944 |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 9-amino-1H-benzo[e][1,3]benzoxazol-2-one |
| SMILES | Nc1cccc2ccc3oc(=O)[nH]c3c12 |
| InChI | InChI=1S/C11H8N2O2/c12-7-3-1-2-6-4-5-8-10(9(6)7)13-11(14)15-8/h1-5H,12H2,(H,13,14) |
| InChIKey | HHGRKSZGTFTFLV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 72.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|