About ethane;naphthalene-1,8-diamine
ethane;naphthalene-1,8-diamine (PubChem CID 90905453) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is ethane;naphthalene-1,8-diamine.
Molecular Properties
| Compound Name | ethane;naphthalene-1,8-diamine |
| PubChem CID | 90905453 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | ethane;naphthalene-1,8-diamine |
| SMILES | CC.Nc1cccc2cccc(N)c12 |
| InChI | InChI=1S/C10H10N2.C2H6/c11-8-5-1-3-7-4-2-6-9(12)10(7)8;1-2/h1-6H,11-12H2;1-2H3 |
| InChIKey | OLSVYUZFNSKKFN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethane;naphthalene-1,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;naphthalene-1,8-diamine?
The IUPAC name of ethane;naphthalene-1,8-diamine (CID 90905453) is ethane;naphthalene-1,8-diamine.
What is the SMILES notation for ethane;naphthalene-1,8-diamine?
The canonical SMILES for ethane;naphthalene-1,8-diamine is CC.Nc1cccc2cccc(N)c12.
What is the InChIKey of ethane;naphthalene-1,8-diamine?
The InChIKey is OLSVYUZFNSKKFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2.C2H6/c11-8-5-1-3-7-4-2-6-9(12)10(7)8;1-2/h1-6H,11-12H2;1-2H3.
What are the key properties of ethane;naphthalene-1,8-diamine?
ethane;naphthalene-1,8-diamine has a molecular weight of 188.27 g/mol, XLogP of 3.03, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;naphthalene-1,8-diamine is sourced from PubChem (CID 90905453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).