C20H20N4 — CID 158469220
naphthalene-1,6-diamine;naphthalene-1,8-diamine (PubChem CID 158469220) has the molecular formula C20H20N4 and a molecular weight of 316.41 g/mol. Its IUPAC name is naphthalene-1,6-diamine;naphthalene-1,8-diamine.
| Compound Name | naphthalene-1,6-diamine;naphthalene-1,8-diamine |
|---|---|
| PubChem CID | 158469220 |
| Molecular Formula | C20H20N4 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | naphthalene-1,6-diamine;naphthalene-1,8-diamine |
| SMILES | Nc1ccc2c(N)cccc2c1.Nc1cccc2cccc(N)c12 |
| InChI | InChI=1S/2C10H10N2/c11-8-5-1-3-7-4-2-6-9(12)10(7)8;11-8-4-5-9-7(6-8)2-1-3-10(9)12/h2*1-6H,11-12H2 |
| InChIKey | HGDIJMVYIUYAHW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|