C34H28N2O6 — CID 164566322
4-[4-[1-(4-formyl-3,5-dimethoxyphenyl)indol-4-yl]indol-1-yl]-2,6-dimethoxybenzaldehyde (PubChem CID 164566322) has the molecular formula C34H28N2O6 and a molecular weight of 560.61 g/mol. Its IUPAC name is 4-[4-[1-(4-formyl-3,5-dimethoxyphenyl)indol-4-yl]indol-1-yl]-2,6-dimethoxybenzaldehyde.
| Compound Name | 4-[4-[1-(4-formyl-3,5-dimethoxyphenyl)indol-4-yl]indol-1-yl]-2,6-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 164566322 |
| Molecular Formula | C34H28N2O6 |
| Molecular Weight | 560.61 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | 4-[4-[1-(4-formyl-3,5-dimethoxyphenyl)indol-4-yl]indol-1-yl]-2,6-dimethoxybenzaldehyde |
| SMILES | COc1cc(-n2ccc3c(-c4cccc5c4ccn5-c4cc(OC)c(C=O)c(OC)c4)cccc32)cc(OC)c1C=O |
| InChI | InChI=1S/C34H28N2O6/c1-39-31-15-21(16-32(40-2)27(31)19-37)35-13-11-25-23(7-5-9-29(25)35)24-8-6-10-30-26(24)12-14-36(30)22-17-33(41-3)28(20-38)34(18-22)42-4/h5-20H,1-4H3 |
| InChIKey | ADRXLUUHEQLPQD-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 80.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.61 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|