C21H27O2P — CID 174395790
4-[hexoxy(phenyl)phosphanyl]-2,6-dimethylbenzaldehyde (PubChem CID 174395790) has the molecular formula C21H27O2P and a molecular weight of 342.42 g/mol. Its IUPAC name is 4-[hexoxy(phenyl)phosphanyl]-2,6-dimethylbenzaldehyde.
| Compound Name | 4-[hexoxy(phenyl)phosphanyl]-2,6-dimethylbenzaldehyde |
|---|---|
| PubChem CID | 174395790 |
| Molecular Formula | C21H27O2P |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 4-[hexoxy(phenyl)phosphanyl]-2,6-dimethylbenzaldehyde |
| SMILES | CCCCCCOP(c1ccccc1)c1cc(C)c(C=O)c(C)c1 |
| InChI | InChI=1S/C21H27O2P/c1-4-5-6-10-13-23-24(19-11-8-7-9-12-19)20-14-17(2)21(16-22)18(3)15-20/h7-9,11-12,14-16H,4-6,10,13H2,1-3H3 |
| InChIKey | WDUDWDCFVGPOQA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|