C28H30O4 — CID 164548433
3,4-dibutoxy-6-(2-phenylphenyl)phthalaldehyde (PubChem CID 164548433) has the molecular formula C28H30O4 and a molecular weight of 430.54 g/mol. Its IUPAC name is 3,4-dibutoxy-6-(2-phenylphenyl)phthalaldehyde.
| Compound Name | 3,4-dibutoxy-6-(2-phenylphenyl)phthalaldehyde |
|---|---|
| PubChem CID | 164548433 |
| Molecular Formula | C28H30O4 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 3,4-dibutoxy-6-(2-phenylphenyl)phthalaldehyde |
| SMILES | CCCCOc1cc(-c2ccccc2-c2ccccc2)c(C=O)c(C=O)c1OCCCC |
| InChI | InChI=1S/C28H30O4/c1-3-5-16-31-27-18-24(25(19-29)26(20-30)28(27)32-17-6-4-2)23-15-11-10-14-22(23)21-12-8-7-9-13-21/h7-15,18-20H,3-6,16-17H2,1-2H3 |
| InChIKey | GHVJXYITOVIALV-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|