C29H32O2 — CID 87274441
6-nonyl-3,4-diphenylphthalaldehyde (PubChem CID 87274441) has the molecular formula C29H32O2 and a molecular weight of 412.57 g/mol. Its IUPAC name is 6-nonyl-3,4-diphenylphthalaldehyde.
| Compound Name | 6-nonyl-3,4-diphenylphthalaldehyde |
|---|---|
| PubChem CID | 87274441 |
| Molecular Formula | C29H32O2 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 6-nonyl-3,4-diphenylphthalaldehyde |
| SMILES | CCCCCCCCCc1cc(-c2ccccc2)c(-c2ccccc2)c(C=O)c1C=O |
| InChI | InChI=1S/C29H32O2/c1-2-3-4-5-6-7-10-19-25-20-26(23-15-11-8-12-16-23)29(24-17-13-9-14-18-24)28(22-31)27(25)21-30/h8-9,11-18,20-22H,2-7,10,19H2,1H3 |
| InChIKey | XQPMEBAKPRCORG-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|