C28H42F2FeP2-6 — CID 87785408
cyclopentane;dicyclohexyl-[5-(4,6-difluorohexan-3-ylphosphanyl)cyclopenta-1,3-dien-1-yl]phosphane;iron (PubChem CID 87785408) has the molecular formula C28H42F2FeP2-6 and a molecular weight of 534.43 g/mol. Its IUPAC name is cyclopentane;dicyclohexyl-[5-(4,6-difluorohexan-3-ylphosphanyl)cyclopenta-1,3-dien-1-yl]phosphane;iron.
| Compound Name | cyclopentane;dicyclohexyl-[5-(4,6-difluorohexan-3-ylphosphanyl)cyclopenta-1,3-dien-1-yl]phosphane;iron |
|---|---|
| PubChem CID | 87785408 |
| Molecular Formula | C28H42F2FeP2-6 |
| Molecular Weight | 534.43 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | cyclopentane;dicyclohexyl-[5-(4,6-difluorohexan-3-ylphosphanyl)cyclopenta-1,3-dien-1-yl]phosphane;iron |
| SMILES | CCC(P[c-]1cccc1P(C1CCCCC1)C1CCCCC1)C(F)CCF.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C23H37F2P2.C5H5.Fe/c1-2-21(20(25)16-17-24)26-22-14-9-15-23(22)27(18-10-5-3-6-11-18)19-12-7-4-8-13-19;1-2-4-5-3-1;/h9,14-15,18-21,26H,2-8,10-13,16-17H2,1H3;1-5H;/q-1;-5; |
| InChIKey | ICIWUOKNHBBFQA-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.43 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|