C22H38NP — CID 162411834
(1S)-1-(2-dicyclohexylphosphanylcyclopenta-2,4-dien-1-yl)-N,N-dimethylpropan-1-amine (PubChem CID 162411834) has the molecular formula C22H38NP and a molecular weight of 347.53 g/mol. Its IUPAC name is (1S)-1-(2-dicyclohexylphosphanylcyclopenta-2,4-dien-1-yl)-N,N-dimethylpropan-1-amine.
| Compound Name | (1S)-1-(2-dicyclohexylphosphanylcyclopenta-2,4-dien-1-yl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 162411834 |
| Molecular Formula | C22H38NP |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.27 |
| IUPAC Name | (1S)-1-(2-dicyclohexylphosphanylcyclopenta-2,4-dien-1-yl)-N,N-dimethylpropan-1-amine |
| SMILES | CC[C@@H](C1C=CC=C1P(C1CCCCC1)C1CCCCC1)N(C)C |
| InChI | InChI=1S/C22H38NP/c1-4-21(23(2)3)20-16-11-17-22(20)24(18-12-7-5-8-13-18)19-14-9-6-10-15-19/h11,16-21H,4-10,12-15H2,1-3H3/t20?,21-/m0/s1 |
| InChIKey | MKIAUWBJGZVXPJ-LBAQZLPGSA-N |
| XLogP | 6.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|