C18H29P — CID 176536164
dicyclohexyl-(5-methylcyclopenta-1,3-dien-1-yl)phosphane (PubChem CID 176536164) has the molecular formula C18H29P and a molecular weight of 276.40 g/mol. Its IUPAC name is dicyclohexyl-(5-methylcyclopenta-1,3-dien-1-yl)phosphane.
| Compound Name | dicyclohexyl-(5-methylcyclopenta-1,3-dien-1-yl)phosphane |
|---|---|
| PubChem CID | 176536164 |
| Molecular Formula | C18H29P |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | dicyclohexyl-(5-methylcyclopenta-1,3-dien-1-yl)phosphane |
| SMILES | CC1C=CC=C1P(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C18H29P/c1-15-9-8-14-18(15)19(16-10-4-2-5-11-16)17-12-6-3-7-13-17/h8-9,14-17H,2-7,10-13H2,1H3 |
| InChIKey | GHKOESICKMTNDO-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|