C34H58P2S — CID 170552424
dicyclohexyl-[4-dicyclohexylphosphanyl-2,5-di(propan-2-yl)thiophen-3-yl]phosphane (PubChem CID 170552424) has the molecular formula C34H58P2S and a molecular weight of 560.85 g/mol. Its IUPAC name is dicyclohexyl-[4-dicyclohexylphosphanyl-2,5-di(propan-2-yl)thiophen-3-yl]phosphane.
| Compound Name | dicyclohexyl-[4-dicyclohexylphosphanyl-2,5-di(propan-2-yl)thiophen-3-yl]phosphane |
|---|---|
| PubChem CID | 170552424 |
| Molecular Formula | C34H58P2S |
| Molecular Weight | 560.85 g/mol |
| Exact Mass | 560.37 |
| IUPAC Name | dicyclohexyl-[4-dicyclohexylphosphanyl-2,5-di(propan-2-yl)thiophen-3-yl]phosphane |
| SMILES | CC(C)c1sc(C(C)C)c(P(C2CCCCC2)C2CCCCC2)c1P(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C34H58P2S/c1-25(2)33-31(35(27-17-9-5-10-18-27)28-19-11-6-12-20-28)32(34(37-33)26(3)4)36(29-21-13-7-14-22-29)30-23-15-8-16-24-30/h25-30H,5-24H2,1-4H3 |
| InChIKey | PERYFQROYNQYSE-UHFFFAOYSA-N |
| XLogP | 11.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.85 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|