C22H36NOP — CID 87395874
2-dicyclohexylphosphanyl-5-[1-(dimethylamino)ethyl]cyclopenta-1,3-diene-1-carbaldehyde (PubChem CID 87395874) has the molecular formula C22H36NOP and a molecular weight of 361.51 g/mol. Its IUPAC name is 2-dicyclohexylphosphanyl-5-[1-(dimethylamino)ethyl]cyclopenta-1,3-diene-1-carbaldehyde.
| Compound Name | 2-dicyclohexylphosphanyl-5-[1-(dimethylamino)ethyl]cyclopenta-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 87395874 |
| Molecular Formula | C22H36NOP |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | 2-dicyclohexylphosphanyl-5-[1-(dimethylamino)ethyl]cyclopenta-1,3-diene-1-carbaldehyde |
| SMILES | CC(C1C=CC(P(C2CCCCC2)C2CCCCC2)=C1C=O)N(C)C |
| InChI | InChI=1S/C22H36NOP/c1-17(23(2)3)20-14-15-22(21(20)16-24)25(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h14-20H,4-13H2,1-3H3 |
| InChIKey | TVLAELVRAHLCJO-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|