C31H40P2 — CID 70795771
dicyclohexyl-[2-[(1R)-1-diphenylphosphanylethyl]cyclopenta-1,4-dien-1-yl]phosphane (PubChem CID 70795771) has the molecular formula C31H40P2 and a molecular weight of 474.61 g/mol. Its IUPAC name is dicyclohexyl-[2-[(1R)-1-diphenylphosphanylethyl]cyclopenta-1,4-dien-1-yl]phosphane.
| Compound Name | dicyclohexyl-[2-[(1R)-1-diphenylphosphanylethyl]cyclopenta-1,4-dien-1-yl]phosphane |
|---|---|
| PubChem CID | 70795771 |
| Molecular Formula | C31H40P2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | dicyclohexyl-[2-[(1R)-1-diphenylphosphanylethyl]cyclopenta-1,4-dien-1-yl]phosphane |
| SMILES | C[C@H](C1=C(P(C2CCCCC2)C2CCCCC2)C=CC1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H40P2/c1-25(32(26-15-6-2-7-16-26)27-17-8-3-9-18-27)30-23-14-24-31(30)33(28-19-10-4-11-20-28)29-21-12-5-13-22-29/h2-3,6-9,14-18,24-25,28-29H,4-5,10-13,19-23H2,1H3/t25-/m1/s1 |
| InChIKey | COOHKRRYOSYZIL-RUZDIDTESA-N |
| XLogP | 8.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|