C27H36P2 — CID 85432950
ditert-butyl-[1-(2-diphenylphosphanylcyclopenta-1,3-dien-1-yl)ethyl]phosphane (PubChem CID 85432950) has the molecular formula C27H36P2 and a molecular weight of 422.53 g/mol. Its IUPAC name is ditert-butyl-[1-(2-diphenylphosphanylcyclopenta-1,3-dien-1-yl)ethyl]phosphane.
| Compound Name | ditert-butyl-[1-(2-diphenylphosphanylcyclopenta-1,3-dien-1-yl)ethyl]phosphane |
|---|---|
| PubChem CID | 85432950 |
| Molecular Formula | C27H36P2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | ditert-butyl-[1-(2-diphenylphosphanylcyclopenta-1,3-dien-1-yl)ethyl]phosphane |
| SMILES | CC(C1=C(P(c2ccccc2)c2ccccc2)C=CC1)P(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C27H36P2/c1-21(29(26(2,3)4)27(5,6)7)24-19-14-20-25(24)28(22-15-10-8-11-16-22)23-17-12-9-13-18-23/h8-18,20-21H,19H2,1-7H3 |
| InChIKey | SIZMJNVIUHVGLI-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|