C24H22NP — CID 101255313
(R)-(2-diphenylphosphanylcyclopenta-1,3-dien-1-yl)-phenylmethanamine (PubChem CID 101255313) has the molecular formula C24H22NP and a molecular weight of 355.42 g/mol. Its IUPAC name is (R)-(2-diphenylphosphanylcyclopenta-1,3-dien-1-yl)-phenylmethanamine.
| Compound Name | (R)-(2-diphenylphosphanylcyclopenta-1,3-dien-1-yl)-phenylmethanamine |
|---|---|
| PubChem CID | 101255313 |
| Molecular Formula | C24H22NP |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | (R)-(2-diphenylphosphanylcyclopenta-1,3-dien-1-yl)-phenylmethanamine |
| SMILES | N[C@@H](C1=C(P(c2ccccc2)c2ccccc2)C=CC1)c1ccccc1 |
| InChI | InChI=1S/C24H22NP/c25-24(19-11-4-1-5-12-19)22-17-10-18-23(22)26(20-13-6-2-7-14-20)21-15-8-3-9-16-21/h1-16,18,24H,17,25H2/t24-/m1/s1 |
| InChIKey | TUERDWLEDJMRGF-XMMPIXPASA-N |
| XLogP | 5.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|