C22H25PS — CID 102370895
[2-(2-methylsulfanylbutyl)cyclopenta-1,4-dien-1-yl]-diphenylphosphane (PubChem CID 102370895) has the molecular formula C22H25PS and a molecular weight of 352.48 g/mol. Its IUPAC name is [2-(2-methylsulfanylbutyl)cyclopenta-1,4-dien-1-yl]-diphenylphosphane.
| Compound Name | [2-(2-methylsulfanylbutyl)cyclopenta-1,4-dien-1-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 102370895 |
| Molecular Formula | C22H25PS |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | [2-(2-methylsulfanylbutyl)cyclopenta-1,4-dien-1-yl]-diphenylphosphane |
| SMILES | CCC(CC1=C(P(c2ccccc2)c2ccccc2)C=CC1)SC |
| InChI | InChI=1S/C22H25PS/c1-3-21(24-2)17-18-11-10-16-22(18)23(19-12-6-4-7-13-19)20-14-8-5-9-15-20/h4-10,12-16,21H,3,11,17H2,1-2H3 |
| InChIKey | JKRHCEJNBZAXHY-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|