C19H20O3P2 — CID 118687805
[(1R)-1-(2-diphenylphosphanylcyclopenta-1,3-dien-1-yl)ethyl]phosphonic acid (PubChem CID 118687805) has the molecular formula C19H20O3P2 and a molecular weight of 358.31 g/mol. Its IUPAC name is [(1R)-1-(2-diphenylphosphanylcyclopenta-1,3-dien-1-yl)ethyl]phosphonic acid.
| Compound Name | [(1R)-1-(2-diphenylphosphanylcyclopenta-1,3-dien-1-yl)ethyl]phosphonic acid |
|---|---|
| PubChem CID | 118687805 |
| Molecular Formula | C19H20O3P2 |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | [(1R)-1-(2-diphenylphosphanylcyclopenta-1,3-dien-1-yl)ethyl]phosphonic acid |
| SMILES | C[C@H](C1=C(P(c2ccccc2)c2ccccc2)C=CC1)P(=O)(O)O |
| InChI | InChI=1S/C19H20O3P2/c1-15(24(20,21)22)18-13-8-14-19(18)23(16-9-4-2-5-10-16)17-11-6-3-7-12-17/h2-12,14-15H,13H2,1H3,(H2,20,21,22)/t15-/m1/s1 |
| InChIKey | ICQOOLARZNPEJC-OAHLLOKOSA-N |
| XLogP | 3.90 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|