C27H27N2O2PS2 — CID 118687923
1-[(1R)-1-(2-diphenylphosphanylcyclopenta-1,3-dien-1-yl)ethyl]-3-(4-methylphenyl)sulfonylthiourea (PubChem CID 118687923) has the molecular formula C27H27N2O2PS2 and a molecular weight of 506.63 g/mol. Its IUPAC name is 1-[(1R)-1-(2-diphenylphosphanylcyclopenta-1,3-dien-1-yl)ethyl]-3-(4-methylphenyl)sulfonylthiourea.
| Compound Name | 1-[(1R)-1-(2-diphenylphosphanylcyclopenta-1,3-dien-1-yl)ethyl]-3-(4-methylphenyl)sulfonylthiourea |
|---|---|
| PubChem CID | 118687923 |
| Molecular Formula | C27H27N2O2PS2 |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | 1-[(1R)-1-(2-diphenylphosphanylcyclopenta-1,3-dien-1-yl)ethyl]-3-(4-methylphenyl)sulfonylthiourea |
| SMILES | Cc1ccc(S(=O)(=O)NC(=S)N[C@H](C)C2=C(P(c3ccccc3)c3ccccc3)C=CC2)cc1 |
| InChI | InChI=1S/C27H27N2O2PS2/c1-20-16-18-24(19-17-20)34(30,31)29-27(33)28-21(2)25-14-9-15-26(25)32(22-10-5-3-6-11-22)23-12-7-4-8-13-23/h3-13,15-19,21H,14H2,1-2H3,(H2,28,29,33)/t21-/m1/s1 |
| InChIKey | VUIIVLPIKIHPMY-OAQYLSRUSA-N |
| XLogP | 4.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|