C20H22NP — CID 12658202
1-(2-diphenylphosphanylcyclopenta-1,3-dien-1-yl)-N,N-dimethylmethanamine (PubChem CID 12658202) has the molecular formula C20H22NP and a molecular weight of 307.38 g/mol. Its IUPAC name is 1-(2-diphenylphosphanylcyclopenta-1,3-dien-1-yl)-N,N-dimethylmethanamine.
| Compound Name | 1-(2-diphenylphosphanylcyclopenta-1,3-dien-1-yl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 12658202 |
| Molecular Formula | C20H22NP |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 1-(2-diphenylphosphanylcyclopenta-1,3-dien-1-yl)-N,N-dimethylmethanamine |
| SMILES | CN(C)CC1=C(P(c2ccccc2)c2ccccc2)C=CC1 |
| InChI | InChI=1S/C20H22NP/c1-21(2)16-17-10-9-15-20(17)22(18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-9,11-15H,10,16H2,1-2H3 |
| InChIKey | FTVHYCXSVJWSKV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|