C26H27NSi — CID 137231043
N,N-dimethyl-1-(2-triphenylsilylcyclopenta-1,4-dien-1-yl)methanamine (PubChem CID 137231043) has the molecular formula C26H27NSi and a molecular weight of 381.60 g/mol. Its IUPAC name is N,N-dimethyl-1-(2-triphenylsilylcyclopenta-1,4-dien-1-yl)methanamine.
| Compound Name | N,N-dimethyl-1-(2-triphenylsilylcyclopenta-1,4-dien-1-yl)methanamine |
|---|---|
| PubChem CID | 137231043 |
| Molecular Formula | C26H27NSi |
| Molecular Weight | 381.60 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | N,N-dimethyl-1-(2-triphenylsilylcyclopenta-1,4-dien-1-yl)methanamine |
| SMILES | CN(C)CC1=C([Si](c2ccccc2)(c2ccccc2)c2ccccc2)CC=C1 |
| InChI | InChI=1S/C26H27NSi/c1-27(2)21-22-13-12-20-26(22)28(23-14-6-3-7-15-23,24-16-8-4-9-17-24)25-18-10-5-11-19-25/h3-19H,20-21H2,1-2H3 |
| InChIKey | MJXGXDAPFZGJJU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.60 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|