C43H60Si — CID 140588420
tris[3,5-di(propan-2-yl)phenyl]-(2-ethylcyclopenta-1,3-dien-1-yl)silane (PubChem CID 140588420) has the molecular formula C43H60Si and a molecular weight of 605.04 g/mol. Its IUPAC name is tris[3,5-di(propan-2-yl)phenyl]-(2-ethylcyclopenta-1,3-dien-1-yl)silane.
| Compound Name | tris[3,5-di(propan-2-yl)phenyl]-(2-ethylcyclopenta-1,3-dien-1-yl)silane |
|---|---|
| PubChem CID | 140588420 |
| Molecular Formula | C43H60Si |
| Molecular Weight | 605.04 g/mol |
| Exact Mass | 604.45 |
| IUPAC Name | tris[3,5-di(propan-2-yl)phenyl]-(2-ethylcyclopenta-1,3-dien-1-yl)silane |
| SMILES | CCC1=C([Si](c2cc(C(C)C)cc(C(C)C)c2)(c2cc(C(C)C)cc(C(C)C)c2)c2cc(C(C)C)cc(C(C)C)c2)CC=C1 |
| InChI | InChI=1S/C43H60Si/c1-14-33-16-15-17-43(33)44(40-21-34(27(2)3)18-35(22-40)28(4)5,41-23-36(29(6)7)19-37(24-41)30(8)9)42-25-38(31(10)11)20-39(26-42)32(12)13/h15-16,18-32H,14,17H2,1-13H3 |
| InChIKey | YDSKSHHZLSSZFG-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.04 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|