C39H52Si — CID 140588540
(2-tert-butylcyclopenta-1,3-dien-1-yl)-tris(3,5-diethylphenyl)silane (PubChem CID 140588540) has the molecular formula C39H52Si and a molecular weight of 548.93 g/mol. Its IUPAC name is (2-tert-butylcyclopenta-1,3-dien-1-yl)-tris(3,5-diethylphenyl)silane.
| Compound Name | (2-tert-butylcyclopenta-1,3-dien-1-yl)-tris(3,5-diethylphenyl)silane |
|---|---|
| PubChem CID | 140588540 |
| Molecular Formula | C39H52Si |
| Molecular Weight | 548.93 g/mol |
| Exact Mass | 548.38 |
| IUPAC Name | (2-tert-butylcyclopenta-1,3-dien-1-yl)-tris(3,5-diethylphenyl)silane |
| SMILES | CCc1cc(CC)cc([Si](C2=C(C(C)(C)C)C=CC2)(c2cc(CC)cc(CC)c2)c2cc(CC)cc(CC)c2)c1 |
| InChI | InChI=1S/C39H52Si/c1-10-28-19-29(11-2)23-34(22-28)40(38-18-16-17-37(38)39(7,8)9,35-24-30(12-3)20-31(13-4)25-35)36-26-32(14-5)21-33(15-6)27-36/h16-17,19-27H,10-15,18H2,1-9H3 |
| InChIKey | GCVRNQZAKPDQNN-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.93 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|