C29H33NSi — CID 23286701
N-[(2-hexylcyclopenta-1,3-dien-1-yl)-diphenylsilyl]aniline (PubChem CID 23286701) has the molecular formula C29H33NSi and a molecular weight of 423.68 g/mol. Its IUPAC name is N-[(2-hexylcyclopenta-1,3-dien-1-yl)-diphenylsilyl]aniline.
| Compound Name | N-[(2-hexylcyclopenta-1,3-dien-1-yl)-diphenylsilyl]aniline |
|---|---|
| PubChem CID | 23286701 |
| Molecular Formula | C29H33NSi |
| Molecular Weight | 423.68 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | N-[(2-hexylcyclopenta-1,3-dien-1-yl)-diphenylsilyl]aniline |
| SMILES | CCCCCCC1=C([Si](Nc2ccccc2)(c2ccccc2)c2ccccc2)CC=C1 |
| InChI | InChI=1S/C29H33NSi/c1-2-3-4-8-16-25-17-15-24-29(25)31(27-20-11-6-12-21-27,28-22-13-7-14-23-28)30-26-18-9-5-10-19-26/h5-7,9-15,17-23,30H,2-4,8,16,24H2,1H3 |
| InChIKey | ZDJSRQLODPSUFG-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.68 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|