C21H33NSi — CID 123463246
N-tert-butyl-N-[methyl(phenyl)silyl]-2-pentylcyclopenta-1,3-dien-1-amine (PubChem CID 123463246) has the molecular formula C21H33NSi and a molecular weight of 327.59 g/mol. Its IUPAC name is N-tert-butyl-N-[methyl(phenyl)silyl]-2-pentylcyclopenta-1,3-dien-1-amine.
| Compound Name | N-tert-butyl-N-[methyl(phenyl)silyl]-2-pentylcyclopenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 123463246 |
| Molecular Formula | C21H33NSi |
| Molecular Weight | 327.59 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | N-tert-butyl-N-[methyl(phenyl)silyl]-2-pentylcyclopenta-1,3-dien-1-amine |
| SMILES | CCCCCC1=C(N([SiH](C)c2ccccc2)C(C)(C)C)CC=C1 |
| InChI | InChI=1S/C21H33NSi/c1-6-7-9-13-18-14-12-17-20(18)22(21(2,3)4)23(5)19-15-10-8-11-16-19/h8,10-12,14-16,23H,6-7,9,13,17H2,1-5H3 |
| InChIKey | MDOSGSCBZIYGLZ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.59 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|