C15H31NSi2 — CID 70307514
1-[dimethyl-(trimethylsilylamino)silyl]-2-pentylcyclopenta-1,3-diene (PubChem CID 70307514) has the molecular formula C15H31NSi2 and a molecular weight of 281.59 g/mol. Its IUPAC name is 1-[dimethyl-(trimethylsilylamino)silyl]-2-pentylcyclopenta-1,3-diene.
| Compound Name | 1-[dimethyl-(trimethylsilylamino)silyl]-2-pentylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 70307514 |
| Molecular Formula | C15H31NSi2 |
| Molecular Weight | 281.59 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 1-[dimethyl-(trimethylsilylamino)silyl]-2-pentylcyclopenta-1,3-diene |
| SMILES | CCCCCC1=C([Si](C)(C)N[Si](C)(C)C)CC=C1 |
| InChI | InChI=1S/C15H31NSi2/c1-7-8-9-11-14-12-10-13-15(14)18(5,6)16-17(2,3)4/h10,12,16H,7-9,11,13H2,1-6H3 |
| InChIKey | RIAIAFPIKUYXMY-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.59 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|