About 2-butylphenol;bis([dimethyl-(trimethylsilylamino)silyl]methane)
2-butylphenol;bis([dimethyl-(trimethylsilylamino)silyl]methane) (PubChem CID 172826507) has the molecular formula C22H52N2OSi4
and a molecular weight of 473.02 g/mol. Its IUPAC name is 2-butylphenol;bis([dimethyl-(trimethylsilylamino)silyl]methane).
Molecular Properties
| Compound Name | 2-butylphenol;bis([dimethyl-(trimethylsilylamino)silyl]methane) |
| PubChem CID | 172826507 |
| Molecular Formula | C22H52N2OSi4 |
| Molecular Weight | 473.02 g/mol |
| Exact Mass | 472.32 |
| IUPAC Name | 2-butylphenol;bis([dimethyl-(trimethylsilylamino)silyl]methane) |
| SMILES | CCCCc1ccccc1O.C[Si](C)(C)N[Si](C)(C)C.C[Si](C)(C)N[Si](C)(C)C |
| InChI | InChI=1S/C10H14O.2C6H19NSi2/c1-2-3-6-9-7-4-5-8-10(9)11;2*1-8(2,3)7-9(4,5)6/h4-5,7-8,11H,2-3,6H2,1H3;2*7H,1-6H3 |
| InChIKey | UXYGPJRYHNOOHL-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.02 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-butylphenol;bis([dimethyl-(trimethylsilylamino)silyl]methane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylphenol;bis([dimethyl-(trimethylsilylamino)silyl]methane)?
The IUPAC name of 2-butylphenol;bis([dimethyl-(trimethylsilylamino)silyl]methane) (CID 172826507) is 2-butylphenol;bis([dimethyl-(trimethylsilylamino)silyl]methane).
What is the SMILES notation for 2-butylphenol;bis([dimethyl-(trimethylsilylamino)silyl]methane)?
The canonical SMILES for 2-butylphenol;bis([dimethyl-(trimethylsilylamino)silyl]methane) is CCCCc1ccccc1O.C[Si](C)(C)N[Si](C)(C)C.C[Si](C)(C)N[Si](C)(C)C.
What is the InChIKey of 2-butylphenol;bis([dimethyl-(trimethylsilylamino)silyl]methane)?
The InChIKey is UXYGPJRYHNOOHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.2C6H19NSi2/c1-2-3-6-9-7-4-5-8-10(9)11;2*1-8(2,3)7-9(4,5)6/h4-5,7-8,11H,2-3,6H2,1H3;2*7H,1-6H3.
What are the key properties of 2-butylphenol;bis([dimethyl-(trimethylsilylamino)silyl]methane)?
2-butylphenol;bis([dimethyl-(trimethylsilylamino)silyl]methane) has a molecular weight of 473.02 g/mol, XLogP of 7.23, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylphenol;bis([dimethyl-(trimethylsilylamino)silyl]methane) is sourced from PubChem (CID 172826507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).